C11H10BrCl — CID 102383415
[(1E,3Z)-4-bromo-4-chloro-3-methylbuta-1,3-dienyl]benzene (PubChem CID 102383415) has the molecular formula C11H10BrCl and a molecular weight of 257.56 g/mol. Its IUPAC name is [(1E,3Z)-4-bromo-4-chloro-3-methylbuta-1,3-dienyl]benzene.
| Compound Name | [(1E,3Z)-4-bromo-4-chloro-3-methylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 102383415 |
| Molecular Formula | C11H10BrCl |
| Molecular Weight | 257.56 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | [(1E,3Z)-4-bromo-4-chloro-3-methylbuta-1,3-dienyl]benzene |
| SMILES | CC(/C=C/c1ccccc1)=C(\Cl)Br |
| InChI | InChI=1S/C11H10BrCl/c1-9(11(12)13)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+,11-9+ |
| InChIKey | JAEYOCDQNKEQHJ-MFDVASPDSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|