C17H15Cl — CID 11680420
[(1Z,3E)-1-chloro-2-methyl-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 11680420) has the molecular formula C17H15Cl and a molecular weight of 254.76 g/mol. Its IUPAC name is [(1Z,3E)-1-chloro-2-methyl-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | [(1Z,3E)-1-chloro-2-methyl-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 11680420 |
| Molecular Formula | C17H15Cl |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [(1Z,3E)-1-chloro-2-methyl-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | CC(/C=C/c1ccccc1)=C(/Cl)c1ccccc1 |
| InChI | InChI=1S/C17H15Cl/c1-14(12-13-15-8-4-2-5-9-15)17(18)16-10-6-3-7-11-16/h2-13H,1H3/b13-12+,17-14- |
| InChIKey | MFVMGAFTCJJBKG-SQCSQLHISA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|