C25H22O — CID 19013042
2-[(1E,3E,5E)-4-methyl-1,6-diphenylhexa-1,3,5-trien-3-yl]phenol (PubChem CID 19013042) has the molecular formula C25H22O and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-4-methyl-1,6-diphenylhexa-1,3,5-trien-3-yl]phenol.
| Compound Name | 2-[(1E,3E,5E)-4-methyl-1,6-diphenylhexa-1,3,5-trien-3-yl]phenol |
|---|---|
| PubChem CID | 19013042 |
| Molecular Formula | C25H22O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[(1E,3E,5E)-4-methyl-1,6-diphenylhexa-1,3,5-trien-3-yl]phenol |
| SMILES | CC(/C=C/c1ccccc1)=C(/C=C/c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C25H22O/c1-20(16-17-21-10-4-2-5-11-21)23(24-14-8-9-15-25(24)26)19-18-22-12-6-3-7-13-22/h2-19,26H,1H3/b17-16+,19-18+,23-20+ |
| InChIKey | XZWKSOUISXIOSX-XCLQMNBZSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|