C23H24 — CID 162275841
[(1E,6E)-2,4,5-trimethyl-3-methylidene-7-phenylhepta-1,4,6-trienyl]benzene (PubChem CID 162275841) has the molecular formula C23H24 and a molecular weight of 300.44 g/mol. Its IUPAC name is [(1E,6E)-2,4,5-trimethyl-3-methylidene-7-phenylhepta-1,4,6-trienyl]benzene.
| Compound Name | [(1E,6E)-2,4,5-trimethyl-3-methylidene-7-phenylhepta-1,4,6-trienyl]benzene |
|---|---|
| PubChem CID | 162275841 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | [(1E,6E)-2,4,5-trimethyl-3-methylidene-7-phenylhepta-1,4,6-trienyl]benzene |
| SMILES | C=C(C(C)=C(C)/C=C/c1ccccc1)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C23H24/c1-18(15-16-22-11-7-5-8-12-22)20(3)21(4)19(2)17-23-13-9-6-10-14-23/h5-17H,4H2,1-3H3/b16-15+,19-17+,20-18? |
| InChIKey | MRPGFFARJXZYHL-GTCLIDTKSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|