C14H19O2Zn- — CID 122206574
2,2-dimethylpropanoate;[(E)-prop-1-enyl]benzene;zinc (PubChem CID 122206574) has the molecular formula C14H19O2Zn- and a molecular weight of 284.69 g/mol. Its IUPAC name is 2,2-dimethylpropanoate;[(E)-prop-1-enyl]benzene;zinc.
| Compound Name | 2,2-dimethylpropanoate;[(E)-prop-1-enyl]benzene;zinc |
|---|---|
| PubChem CID | 122206574 |
| Molecular Formula | C14H19O2Zn- |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2,2-dimethylpropanoate;[(E)-prop-1-enyl]benzene;zinc |
| SMILES | C/C=C/c1ccccc1.CC(C)(C)C(=O)[O-].[Zn] |
| InChI | InChI=1S/C9H10.C5H10O2.Zn/c1-2-6-9-7-4-3-5-8-9;1-5(2,3)4(6)7;/h2-8H,1H3;1-3H3,(H,6,7);/p-1/b6-2+;; |
| InChIKey | VHYGQUSHKWEWKJ-UKBMIWHLSA-M |
| XLogP | 2.50 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|