About prop-1-enylbenzene;trimethylazanium;bromide
prop-1-enylbenzene;trimethylazanium;bromide (PubChem CID 69252782) has the molecular formula C12H20BrN
and a molecular weight of 258.20 g/mol. Its IUPAC name is prop-1-enylbenzene;trimethylazanium;bromide.
Molecular Properties
| Compound Name | prop-1-enylbenzene;trimethylazanium;bromide |
| PubChem CID | 69252782 |
| Molecular Formula | C12H20BrN |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | prop-1-enylbenzene;trimethylazanium;bromide |
| SMILES | CC=Cc1ccccc1.C[NH+](C)C.[Br-] |
| InChI | InChI=1S/C9H10.C3H9N.BrH/c1-2-6-9-7-4-3-5-8-9;1-4(2)3;/h2-8H,1H3;1-3H3;1H |
| InChIKey | LPUCYUBAJZSGLI-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze prop-1-enylbenzene;trimethylazanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-enylbenzene;trimethylazanium;bromide?
The IUPAC name of prop-1-enylbenzene;trimethylazanium;bromide (CID 69252782) is prop-1-enylbenzene;trimethylazanium;bromide.
What is the SMILES notation for prop-1-enylbenzene;trimethylazanium;bromide?
The canonical SMILES for prop-1-enylbenzene;trimethylazanium;bromide is CC=Cc1ccccc1.C[NH+](C)C.[Br-].
What is the InChIKey of prop-1-enylbenzene;trimethylazanium;bromide?
The InChIKey is LPUCYUBAJZSGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C3H9N.BrH/c1-2-6-9-7-4-3-5-8-9;1-4(2)3;/h2-8H,1H3;1-3H3;1H.
What are the key properties of prop-1-enylbenzene;trimethylazanium;bromide?
prop-1-enylbenzene;trimethylazanium;bromide has a molecular weight of 258.20 g/mol, XLogP of -1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-enylbenzene;trimethylazanium;bromide is sourced from PubChem (CID 69252782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).