About 2-deuterioethenylbenzene;prop-1-enylbenzene
2-deuterioethenylbenzene;prop-1-enylbenzene (PubChem CID 162227902) has the molecular formula C17H18
and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-deuterioethenylbenzene;prop-1-enylbenzene.
Molecular Properties
| Compound Name | 2-deuterioethenylbenzene;prop-1-enylbenzene |
| PubChem CID | 162227902 |
| Molecular Formula | C17H18 |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 2-deuterioethenylbenzene;prop-1-enylbenzene |
| SMILES | CC=Cc1ccccc1.[2H]/C=C/c1ccccc1 |
| InChI | InChI=1S/C9H10.C8H8/c1-2-6-9-7-4-3-5-8-9;1-2-8-6-4-3-5-7-8/h2-8H,1H3;2-7H,1H2/i;1D/b;2-1+ |
| InChIKey | ZUZSFMQBICMDEZ-IMOHWSRDSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-deuterioethenylbenzene;prop-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterioethenylbenzene;prop-1-enylbenzene?
The IUPAC name of 2-deuterioethenylbenzene;prop-1-enylbenzene (CID 162227902) is 2-deuterioethenylbenzene;prop-1-enylbenzene.
What is the SMILES notation for 2-deuterioethenylbenzene;prop-1-enylbenzene?
The canonical SMILES for 2-deuterioethenylbenzene;prop-1-enylbenzene is CC=Cc1ccccc1.[2H]/C=C/c1ccccc1.
What is the InChIKey of 2-deuterioethenylbenzene;prop-1-enylbenzene?
The InChIKey is ZUZSFMQBICMDEZ-IMOHWSRDSA-N. The full InChI is InChI=1S/C9H10.C8H8/c1-2-6-9-7-4-3-5-8-9;1-2-8-6-4-3-5-7-8/h2-8H,1H3;2-7H,1H2/i;1D/b;2-1+.
What are the key properties of 2-deuterioethenylbenzene;prop-1-enylbenzene?
2-deuterioethenylbenzene;prop-1-enylbenzene has a molecular weight of 223.34 g/mol, XLogP of 5.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterioethenylbenzene;prop-1-enylbenzene is sourced from PubChem (CID 162227902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).