C15H24S — CID 142555461
ethane;(2E,4Z)-hexa-2,4-diene-2-thiol;toluene (PubChem CID 142555461) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is ethane;(2E,4Z)-hexa-2,4-diene-2-thiol;toluene.
| Compound Name | ethane;(2E,4Z)-hexa-2,4-diene-2-thiol;toluene |
|---|---|
| PubChem CID | 142555461 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | ethane;(2E,4Z)-hexa-2,4-diene-2-thiol;toluene |
| SMILES | C/C=C\C=C(/C)S.CC.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C6H10S.C2H6/c1-7-5-3-2-4-6-7;1-3-4-5-6(2)7;1-2/h2-6H,1H3;3-5,7H,1-2H3;1-2H3/b;4-3-,6-5+; |
| InChIKey | GRORDKNVLSMHDD-UJBRKUMZSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|