C8H16S — CID 143240532
ethane;(2Z,4E)-hexa-2,4-diene-2-thiol (PubChem CID 143240532) has the molecular formula C8H16S and a molecular weight of 144.28 g/mol. Its IUPAC name is ethane;(2Z,4E)-hexa-2,4-diene-2-thiol.
| Compound Name | ethane;(2Z,4E)-hexa-2,4-diene-2-thiol |
|---|---|
| PubChem CID | 143240532 |
| Molecular Formula | C8H16S |
| Molecular Weight | 144.28 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | ethane;(2Z,4E)-hexa-2,4-diene-2-thiol |
| SMILES | C/C=C/C=C(/C)S.CC |
| InChI | InChI=1S/C6H10S.C2H6/c1-3-4-5-6(2)7;1-2/h3-5,7H,1-2H3;1-2H3/b4-3+,6-5-; |
| InChIKey | VJIXEAVIRSDBBX-SFXPHMRKSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|