About ethane;(2Z,4E)-hexa-2,4-diene-2-thiol
ethane;(2Z,4E)-hexa-2,4-diene-2-thiol (PubChem CID 143240532) has the molecular formula C8H16S
and a molecular weight of 144.28 g/mol. Its IUPAC name is ethane;(2Z,4E)-hexa-2,4-diene-2-thiol.
Molecular Properties
| Compound Name | ethane;(2Z,4E)-hexa-2,4-diene-2-thiol |
| PubChem CID | 143240532 |
| Molecular Formula | C8H16S |
| Molecular Weight | 144.28 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | ethane;(2Z,4E)-hexa-2,4-diene-2-thiol |
| SMILES | C/C=C/C=C(/C)S.CC |
| InChI | InChI=1S/C6H10S.C2H6/c1-3-4-5-6(2)7;1-2/h3-5,7H,1-2H3;1-2H3/b4-3+,6-5-; |
| InChIKey | VJIXEAVIRSDBBX-SFXPHMRKSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2Z,4E)-hexa-2,4-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2Z,4E)-hexa-2,4-diene-2-thiol?
The IUPAC name of ethane;(2Z,4E)-hexa-2,4-diene-2-thiol (CID 143240532) is ethane;(2Z,4E)-hexa-2,4-diene-2-thiol.
What is the SMILES notation for ethane;(2Z,4E)-hexa-2,4-diene-2-thiol?
The canonical SMILES for ethane;(2Z,4E)-hexa-2,4-diene-2-thiol is C/C=C/C=C(/C)S.CC.
What is the InChIKey of ethane;(2Z,4E)-hexa-2,4-diene-2-thiol?
The InChIKey is VJIXEAVIRSDBBX-SFXPHMRKSA-N. The full InChI is InChI=1S/C6H10S.C2H6/c1-3-4-5-6(2)7;1-2/h3-5,7H,1-2H3;1-2H3/b4-3+,6-5-;.
What are the key properties of ethane;(2Z,4E)-hexa-2,4-diene-2-thiol?
ethane;(2Z,4E)-hexa-2,4-diene-2-thiol has a molecular weight of 144.28 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2Z,4E)-hexa-2,4-diene-2-thiol is sourced from PubChem (CID 143240532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).