C10H17Cl — CID 145128135
(3E,5Z)-3-chloro-2-methylhepta-1,3,5-triene;ethane (PubChem CID 145128135) has the molecular formula C10H17Cl and a molecular weight of 172.70 g/mol. Its IUPAC name is (3E,5Z)-3-chloro-2-methylhepta-1,3,5-triene;ethane.
| Compound Name | (3E,5Z)-3-chloro-2-methylhepta-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 145128135 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (3E,5Z)-3-chloro-2-methylhepta-1,3,5-triene;ethane |
| SMILES | C=C(C)/C(Cl)=C\C=C/C.CC |
| InChI | InChI=1S/C8H11Cl.C2H6/c1-4-5-6-8(9)7(2)3;1-2/h4-6H,2H2,1,3H3;1-2H3/b5-4-,8-6+; |
| InChIKey | XTRKBNCNJYQBLM-NLAQHMENSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|