C8H10Cl2 — CID 143227932
(3E,5Z)-3,7-dichloro-2-methylhepta-1,3,5-triene (PubChem CID 143227932) has the molecular formula C8H10Cl2 and a molecular weight of 177.07 g/mol. Its IUPAC name is (3E,5Z)-3,7-dichloro-2-methylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-3,7-dichloro-2-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143227932 |
| Molecular Formula | C8H10Cl2 |
| Molecular Weight | 177.07 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | (3E,5Z)-3,7-dichloro-2-methylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(Cl)=C\C=C/CCl |
| InChI | InChI=1S/C8H10Cl2/c1-7(2)8(10)5-3-4-6-9/h3-5H,1,6H2,2H3/b4-3-,8-5+ |
| InChIKey | SNPNWIJBTADPRG-HMRFFJRGSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.07 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|