C7H12ClN — CID 88940379
(3Z,5E)-6-chlorohepta-3,5-dien-1-amine (PubChem CID 88940379) has the molecular formula C7H12ClN and a molecular weight of 145.63 g/mol. Its IUPAC name is (3Z,5E)-6-chlorohepta-3,5-dien-1-amine.
| Compound Name | (3Z,5E)-6-chlorohepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 88940379 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (3Z,5E)-6-chlorohepta-3,5-dien-1-amine |
| SMILES | C/C(Cl)=C\C=C/CCN |
| InChI | InChI=1S/C7H12ClN/c1-7(8)5-3-2-4-6-9/h2-3,5H,4,6,9H2,1H3/b3-2-,7-5+ |
| InChIKey | XYKIOACPXFPSRV-JYUXVSJCSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|