C9H10F3N — CID 143883504
(3Z,5E)-6-(trifluoromethyl)octa-3,5-dien-7-yn-1-amine (PubChem CID 143883504) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is (3Z,5E)-6-(trifluoromethyl)octa-3,5-dien-7-yn-1-amine.
| Compound Name | (3Z,5E)-6-(trifluoromethyl)octa-3,5-dien-7-yn-1-amine |
|---|---|
| PubChem CID | 143883504 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (3Z,5E)-6-(trifluoromethyl)octa-3,5-dien-7-yn-1-amine |
| SMILES | C#C/C(=C\C=C/CCN)C(F)(F)F |
| InChI | InChI=1S/C9H10F3N/c1-2-8(9(10,11)12)6-4-3-5-7-13/h1,3-4,6H,5,7,13H2/b4-3-,8-6+ |
| InChIKey | KGVFXEUGXKHXKY-OONGGIDMSA-N |
| XLogP | 2.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|