C10H10F3NO — CID 134894148
N-ethynyl-2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]acetamide (PubChem CID 134894148) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is N-ethynyl-2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]acetamide.
| Compound Name | N-ethynyl-2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]acetamide |
|---|---|
| PubChem CID | 134894148 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-ethynyl-2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]acetamide |
| SMILES | C#CN(CC/C=C/C=C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO/c1-3-5-6-7-8-14(4-2)9(15)10(11,12)13/h2-3,5-6H,1,7-8H2/b6-5+ |
| InChIKey | PCUWBGCGAHNKNB-AATRIKPKSA-N |
| XLogP | 2.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|