About imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium
imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium (PubChem CID 6333930) has the molecular formula C8H11N2O+
and a molecular weight of 151.19 g/mol. Its IUPAC name is imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium.
Molecular Properties
| Compound Name | imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium |
| PubChem CID | 6333930 |
| Molecular Formula | C8H11N2O+ |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium |
| SMILES | C=C/C=C/CCC(=O)C=[N+]=N |
| InChI | InChI=1S/C8H11N2O/c1-2-3-4-5-6-8(11)7-10-9/h2-4,7,9H,1,5-6H2/q+1/b4-3+ |
| InChIKey | LFTDUYNEVVKZRW-ONEGZZNKSA-N |
| XLogP | 1.39 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium?
The IUPAC name of imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium (CID 6333930) is imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium.
What is the SMILES notation for imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium?
The canonical SMILES for imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium is C=C/C=C/CCC(=O)C=[N+]=N.
What is the InChIKey of imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium?
The InChIKey is LFTDUYNEVVKZRW-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H11N2O/c1-2-3-4-5-6-8(11)7-10-9/h2-4,7,9H,1,5-6H2/q+1/b4-3+.
What are the key properties of imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium?
imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium has a molecular weight of 151.19 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imino-[(5E)-2-oxoocta-5,7-dienylidene]azanium is sourced from PubChem (CID 6333930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).