C12H16O — CID 168893799
dodeca-2,7,9,11-tetraen-4-one (PubChem CID 168893799) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is dodeca-2,7,9,11-tetraen-4-one.
| Compound Name | dodeca-2,7,9,11-tetraen-4-one |
|---|---|
| PubChem CID | 168893799 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | dodeca-2,7,9,11-tetraen-4-one |
| SMILES | C=CC=CC=CCCC(=O)C=CC |
| InChI | InChI=1S/C12H16O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h3-8,10H,1,9,11H2,2H3 |
| InChIKey | BAZWJAMNQVFPDN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|