C9H13BrO — CID 143346548
(2E,7E)-9-bromonona-2,7-dien-4-one (PubChem CID 143346548) has the molecular formula C9H13BrO and a molecular weight of 217.11 g/mol. Its IUPAC name is (2E,7E)-9-bromonona-2,7-dien-4-one.
| Compound Name | (2E,7E)-9-bromonona-2,7-dien-4-one |
|---|---|
| PubChem CID | 143346548 |
| Molecular Formula | C9H13BrO |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | (2E,7E)-9-bromonona-2,7-dien-4-one |
| SMILES | C/C=C/C(=O)CC/C=C/CBr |
| InChI | InChI=1S/C9H13BrO/c1-2-6-9(11)7-4-3-5-8-10/h2-3,5-6H,4,7-8H2,1H3/b5-3+,6-2+ |
| InChIKey | ZMFJCHJDVGCGLU-BNNIKMIXSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|