C11H14O4 — CID 162332753
(Z)-but-2-enedioic acid;hepta-1,3,5-triene (PubChem CID 162332753) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;hepta-1,3,5-triene.
| Compound Name | (Z)-but-2-enedioic acid;hepta-1,3,5-triene |
|---|---|
| PubChem CID | 162332753 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (Z)-but-2-enedioic acid;hepta-1,3,5-triene |
| SMILES | C=CC=CC=CC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C7H10.C4H4O4/c1-3-5-7-6-4-2;5-3(6)1-2-4(7)8/h3-7H,1H2,2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WTLFMLPHRKCCEQ-BTJKTKAUSA-N |
| XLogP | 2.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|