C14H21NO — CID 10932951
(E)-N-[(3E)-hexa-3,5-dienyl]-N-(2-methylprop-2-enyl)but-2-enamide (PubChem CID 10932951) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (E)-N-[(3E)-hexa-3,5-dienyl]-N-(2-methylprop-2-enyl)but-2-enamide.
| Compound Name | (E)-N-[(3E)-hexa-3,5-dienyl]-N-(2-methylprop-2-enyl)but-2-enamide |
|---|---|
| PubChem CID | 10932951 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (E)-N-[(3E)-hexa-3,5-dienyl]-N-(2-methylprop-2-enyl)but-2-enamide |
| SMILES | C=C/C=C/CCN(CC(=C)C)C(=O)/C=C/C |
| InChI | InChI=1S/C14H21NO/c1-5-7-8-9-11-15(12-13(3)4)14(16)10-6-2/h5-8,10H,1,3,9,11-12H2,2,4H3/b8-7+,10-6+ |
| InChIKey | MBJDAKSLDLRFRC-IQXTZUCASA-N |
| XLogP | 3.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|