C11H14N2O — CID 134505058
(Z)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methanimidoylbut-2-enamide (PubChem CID 134505058) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (Z)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methanimidoylbut-2-enamide.
| Compound Name | (Z)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methanimidoylbut-2-enamide |
|---|---|
| PubChem CID | 134505058 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (Z)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-N-methanimidoylbut-2-enamide |
| SMILES | [H]/N=C/N(C(=C)/C=C\C=C)C(=O)/C=C\C |
| InChI | InChI=1S/C11H14N2O/c1-4-6-8-10(3)13(9-12)11(14)7-5-2/h4-9,12H,1,3H2,2H3/b7-5-,8-6-,12-9+ |
| InChIKey | MMJDBGAZJCLFGM-VPHISVRJSA-N |
| XLogP | 2.25 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|