C7H9N — CID 145448043
(3Z)-2-methylidenehexa-3,5-dien-1-imine (PubChem CID 145448043) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is (3Z)-2-methylidenehexa-3,5-dien-1-imine.
| Compound Name | (3Z)-2-methylidenehexa-3,5-dien-1-imine |
|---|---|
| PubChem CID | 145448043 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | (3Z)-2-methylidenehexa-3,5-dien-1-imine |
| SMILES | [H]/N=C/C(=C)/C=C\C=C |
| InChI | InChI=1S/C7H9N/c1-3-4-5-7(2)6-8/h3-6,8H,1-2H2/b5-4-,8-6+ |
| InChIKey | NQEQNZUIMUTQRV-GSGSLZOQSA-N |
| XLogP | 1.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|