C5H8N2 — CID 141285400
penta-2,4-dienimidamide (PubChem CID 141285400) has the molecular formula C5H8N2 and a molecular weight of 96.13 g/mol. Its IUPAC name is penta-2,4-dienimidamide.
| Compound Name | penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 141285400 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | penta-2,4-dienimidamide |
| SMILES | [H]/N=C(/N)C=CC=C |
| InChI | InChI=1S/C5H8N2/c1-2-3-4-5(6)7/h2-4H,1H2,(H3,6,7) |
| InChIKey | AAFDSAVDFQTFBA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|