C10H17N — CID 145093627
ethane;(4Z)-2-methylhepta-1,4,6-trien-3-imine (PubChem CID 145093627) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is ethane;(4Z)-2-methylhepta-1,4,6-trien-3-imine.
| Compound Name | ethane;(4Z)-2-methylhepta-1,4,6-trien-3-imine |
|---|---|
| PubChem CID | 145093627 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | ethane;(4Z)-2-methylhepta-1,4,6-trien-3-imine |
| SMILES | CC.[H]/N=C(/C=C\C=C)C(=C)C |
| InChI | InChI=1S/C8H11N.C2H6/c1-4-5-6-8(9)7(2)3;1-2/h4-6,9H,1-2H2,3H3;1-2H3/b6-5-,9-8-; |
| InChIKey | YUORFXNOGQGYFB-YYYWGHDMSA-N |
| XLogP | 3.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|