C9H15N — CID 123954860
(4Z)-2,6-dimethylhepta-1,4-dien-3-imine (PubChem CID 123954860) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (4Z)-2,6-dimethylhepta-1,4-dien-3-imine.
| Compound Name | (4Z)-2,6-dimethylhepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123954860 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (4Z)-2,6-dimethylhepta-1,4-dien-3-imine |
| SMILES | [H]/N=C(/C=C\C(C)C)C(=C)C |
| InChI | InChI=1S/C9H15N/c1-7(2)5-6-9(10)8(3)4/h5-7,10H,3H2,1-2,4H3/b6-5-,10-9- |
| InChIKey | OKXLJWLGLPBQEC-WBHJMADESA-N |
| XLogP | 2.79 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|