C9H16N2 — CID 176949454
(3Z)-5-imino-2,6-dimethylhepta-3,6-dien-3-amine (PubChem CID 176949454) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3Z)-5-imino-2,6-dimethylhepta-3,6-dien-3-amine.
| Compound Name | (3Z)-5-imino-2,6-dimethylhepta-3,6-dien-3-amine |
|---|---|
| PubChem CID | 176949454 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3Z)-5-imino-2,6-dimethylhepta-3,6-dien-3-amine |
| SMILES | [H]/N=C(/C=C(\N)C(C)C)C(=C)C |
| InChI | InChI=1S/C9H16N2/c1-6(2)8(10)5-9(11)7(3)4/h5,7,10H,1,11H2,2-4H3/b9-5-,10-8- |
| InChIKey | PWUPPUFDAVZYEI-UDRCNDPASA-N |
| XLogP | 2.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|