About 2-Methylpropanimidamide hydrochloride
2-Methylpropanimidamide hydrochloride (PubChem CID 2782053) has the molecular formula C4H11ClN2
and a molecular weight of 122.60 g/mol. Its IUPAC name is 2-methylpropanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-Methylpropanimidamide hydrochloride |
| PubChem CID | 2782053 |
| Molecular Formula | C4H11ClN2 |
| Molecular Weight | 122.60 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 2-methylpropanimidamide;hydrochloride |
| SMILES | CC(C)C(=N)N.Cl |
| InChI | InChI=1S/C4H10N2.ClH/c1-3(2)4(5)6;/h3H,1-2H3,(H3,5,6);1H |
| InChIKey | VWXLCWNPSOUPPE-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 49.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | 56 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-Methylpropanimidamide hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Methylpropanimidamide hydrochloride?
The IUPAC name of 2-Methylpropanimidamide hydrochloride (CID 2782053) is 2-methylpropanimidamide;hydrochloride.
What is the SMILES notation for 2-Methylpropanimidamide hydrochloride?
The canonical SMILES for 2-Methylpropanimidamide hydrochloride is CC(C)C(=N)N.Cl.
What is the InChIKey of 2-Methylpropanimidamide hydrochloride?
The InChIKey is VWXLCWNPSOUPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2.ClH/c1-3(2)4(5)6;/h3H,1-2H3,(H3,5,6);1H.
What are the key properties of 2-Methylpropanimidamide hydrochloride?
2-Methylpropanimidamide hydrochloride has a molecular weight of 122.60 g/mol, XLogP of not available, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Methylpropanimidamide hydrochloride is sourced from PubChem (CID 2782053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).