C5H11N3O3 — CID 118525619
[(2S)-4-amino-3-hydroxy-4-iminobutan-2-yl]carbamic acid (PubChem CID 118525619) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is [(2S)-4-amino-3-hydroxy-4-iminobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-4-amino-3-hydroxy-4-iminobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118525619 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | [(2S)-4-amino-3-hydroxy-4-iminobutan-2-yl]carbamic acid |
| SMILES | [H]/N=C(\N)C(O)[C@H](C)NC(=O)O |
| InChI | InChI=1S/C5H11N3O3/c1-2(8-5(10)11)3(9)4(6)7/h2-3,8-9H,1H3,(H3,6,7)(H,10,11)/t2-,3?/m0/s1 |
| InChIKey | WNLOGQNSGGPPCL-SCQFTWEKSA-N |
| XLogP | -1.06 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|