C5H11N5O2 — CID 141220669
(3-amino-2-carbamimidoyl-3-iminopropyl)carbamic acid (PubChem CID 141220669) has the molecular formula C5H11N5O2 and a molecular weight of 173.18 g/mol. Its IUPAC name is (3-amino-2-carbamimidoyl-3-iminopropyl)carbamic acid.
| Compound Name | (3-amino-2-carbamimidoyl-3-iminopropyl)carbamic acid |
|---|---|
| PubChem CID | 141220669 |
| Molecular Formula | C5H11N5O2 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | (3-amino-2-carbamimidoyl-3-iminopropyl)carbamic acid |
| SMILES | [H]/N=C(\N)C(CNC(=O)O)/C(N)=N/[H] |
| InChI | InChI=1S/C5H11N5O2/c6-3(7)2(4(8)9)1-10-5(11)12/h2,10H,1H2,(H3,6,7)(H3,8,9)(H,11,12) |
| InChIKey | YMRGBZGMHFGBDI-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|