C10H18N8O2 — CID 87475133
2,5-dioxohexane-1,1,6,6-tetracarboximidamide (PubChem CID 87475133) has the molecular formula C10H18N8O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2,5-dioxohexane-1,1,6,6-tetracarboximidamide.
| Compound Name | 2,5-dioxohexane-1,1,6,6-tetracarboximidamide |
|---|---|
| PubChem CID | 87475133 |
| Molecular Formula | C10H18N8O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2,5-dioxohexane-1,1,6,6-tetracarboximidamide |
| SMILES | [H]/N=C(\N)C(C(=O)CCC(=O)C(/C(N)=N/[H])/C(N)=N/[H])/C(N)=N/[H] |
| InChI | InChI=1S/C10H18N8O2/c11-7(12)5(8(13)14)3(19)1-2-4(20)6(9(15)16)10(17)18/h5-6H,1-2H2,(H3,11,12)(H3,13,14)(H3,15,16)(H3,17,18) |
| InChIKey | RTCHKYALHSMILH-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 233.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|