C5H11N5O2 — CID 123374487
3-amino-2-[(2-amino-2-oxoethyl)amino]-3-iminopropanamide (PubChem CID 123374487) has the molecular formula C5H11N5O2 and a molecular weight of 173.18 g/mol. Its IUPAC name is 3-amino-2-[(2-amino-2-oxoethyl)amino]-3-iminopropanamide.
| Compound Name | 3-amino-2-[(2-amino-2-oxoethyl)amino]-3-iminopropanamide |
|---|---|
| PubChem CID | 123374487 |
| Molecular Formula | C5H11N5O2 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 3-amino-2-[(2-amino-2-oxoethyl)amino]-3-iminopropanamide |
| SMILES | [H]/N=C(\N)C(NCC(N)=O)C(N)=O |
| InChI | InChI=1S/C5H11N5O2/c6-2(11)1-10-3(4(7)8)5(9)12/h3,10H,1H2,(H2,6,11)(H3,7,8)(H2,9,12) |
| InChIKey | CPQXKQLPRDUKJE-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|