C6H15N5O — CID 123532737
3-amino-2-(2-aminoethylamino)-3-imino-N-methylpropanamide (PubChem CID 123532737) has the molecular formula C6H15N5O and a molecular weight of 173.22 g/mol. Its IUPAC name is 3-amino-2-(2-aminoethylamino)-3-imino-N-methylpropanamide.
| Compound Name | 3-amino-2-(2-aminoethylamino)-3-imino-N-methylpropanamide |
|---|---|
| PubChem CID | 123532737 |
| Molecular Formula | C6H15N5O |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | 3-amino-2-(2-aminoethylamino)-3-imino-N-methylpropanamide |
| SMILES | [H]/N=C(\N)C(NCCN)C(=O)NC |
| InChI | InChI=1S/C6H15N5O/c1-10-6(12)4(5(8)9)11-3-2-7/h4,11H,2-3,7H2,1H3,(H3,8,9)(H,10,12) |
| InChIKey | JOXSWPYPDVIQQM-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|