C6H13N5O2 — CID 123166598
3-amino-2-[(2-amino-2-oxoethyl)amino]-3-imino-N-methylpropanamide (PubChem CID 123166598) has the molecular formula C6H13N5O2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-amino-2-[(2-amino-2-oxoethyl)amino]-3-imino-N-methylpropanamide.
| Compound Name | 3-amino-2-[(2-amino-2-oxoethyl)amino]-3-imino-N-methylpropanamide |
|---|---|
| PubChem CID | 123166598 |
| Molecular Formula | C6H13N5O2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-amino-2-[(2-amino-2-oxoethyl)amino]-3-imino-N-methylpropanamide |
| SMILES | [H]/N=C(\N)C(NCC(N)=O)C(=O)NC |
| InChI | InChI=1S/C6H13N5O2/c1-10-6(13)4(5(8)9)11-2-3(7)12/h4,11H,2H2,1H3,(H2,7,12)(H3,8,9)(H,10,13) |
| InChIKey | MBTKQSIVMWTZLS-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|