C4H10N4O — CID 123527174
2,3-diamino-3-imino-N-methylpropanamide (PubChem CID 123527174) has the molecular formula C4H10N4O and a molecular weight of 130.15 g/mol. Its IUPAC name is 2,3-diamino-3-imino-N-methylpropanamide.
| Compound Name | 2,3-diamino-3-imino-N-methylpropanamide |
|---|---|
| PubChem CID | 123527174 |
| Molecular Formula | C4H10N4O |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 2,3-diamino-3-imino-N-methylpropanamide |
| SMILES | [H]/N=C(\N)C(N)C(=O)NC |
| InChI | InChI=1S/C4H10N4O/c1-8-4(9)2(5)3(6)7/h2H,5H2,1H3,(H3,6,7)(H,8,9) |
| InChIKey | RYERRLJZFAXVRO-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|