C7H16ClN5O2 — CID 141396645
2,3-diamino-N-(2-amino-2-oxoethyl)-3-ethyliminopropanamide;hydrochloride (PubChem CID 141396645) has the molecular formula C7H16ClN5O2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 2,3-diamino-N-(2-amino-2-oxoethyl)-3-ethyliminopropanamide;hydrochloride.
| Compound Name | 2,3-diamino-N-(2-amino-2-oxoethyl)-3-ethyliminopropanamide;hydrochloride |
|---|---|
| PubChem CID | 141396645 |
| Molecular Formula | C7H16ClN5O2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,3-diamino-N-(2-amino-2-oxoethyl)-3-ethyliminopropanamide;hydrochloride |
| SMILES | CC/N=C(\N)C(N)C(=O)NCC(N)=O.Cl |
| InChI | InChI=1S/C7H15N5O2.ClH/c1-2-11-6(10)5(9)7(14)12-3-4(8)13;/h5H,2-3,9H2,1H3,(H2,8,13)(H2,10,11)(H,12,14);1H |
| InChIKey | YMKOKDFXSMCQSG-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|