C10H20N6O3 — CID 21035897
3-(diaminomethylideneamino)-2-[[2-(methylamino)acetyl]amino]-N-(2-oxopropyl)propanamide (PubChem CID 21035897) has the molecular formula C10H20N6O3 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-2-[[2-(methylamino)acetyl]amino]-N-(2-oxopropyl)propanamide.
| Compound Name | 3-(diaminomethylideneamino)-2-[[2-(methylamino)acetyl]amino]-N-(2-oxopropyl)propanamide |
|---|---|
| PubChem CID | 21035897 |
| Molecular Formula | C10H20N6O3 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-(diaminomethylideneamino)-2-[[2-(methylamino)acetyl]amino]-N-(2-oxopropyl)propanamide |
| SMILES | CNCC(=O)NC(CN=C(N)N)C(=O)NCC(C)=O |
| InChI | InChI=1S/C10H20N6O3/c1-6(17)3-14-9(19)7(4-15-10(11)12)16-8(18)5-13-2/h7,13H,3-5H2,1-2H3,(H,14,19)(H,16,18)(H4,11,12,15) |
| InChIKey | JKFQJJVZWYNSLH-UHFFFAOYSA-N |
| XLogP | -3.33 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|