C14H28N6O5S — CID 20579675
N-[2-(butoxysulfinylamino)-3-oxobutyl]-3-[[2-(diaminomethylideneamino)acetyl]amino]propanamide (PubChem CID 20579675) has the molecular formula C14H28N6O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[2-(butoxysulfinylamino)-3-oxobutyl]-3-[[2-(diaminomethylideneamino)acetyl]amino]propanamide.
| Compound Name | N-[2-(butoxysulfinylamino)-3-oxobutyl]-3-[[2-(diaminomethylideneamino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 20579675 |
| Molecular Formula | C14H28N6O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[2-(butoxysulfinylamino)-3-oxobutyl]-3-[[2-(diaminomethylideneamino)acetyl]amino]propanamide |
| SMILES | CCCCOS(=O)NC(CNC(=O)CCNC(=O)CN=C(N)N)C(C)=O |
| InChI | InChI=1S/C14H28N6O5S/c1-3-4-7-25-26(24)20-11(10(2)21)8-18-12(22)5-6-17-13(23)9-19-14(15)16/h11,20H,3-9H2,1-2H3,(H,17,23)(H,18,22)(H4,15,16,19) |
| InChIKey | JBLKEURUCQCAGO-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|