About 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride
3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride (PubChem CID 87498740) has the molecular formula C8H15ClN6O4
and a molecular weight of 294.70 g/mol. Its IUPAC name is 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride |
| PubChem CID | 87498740 |
| Molecular Formula | C8H15ClN6O4 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(C/N=N/CC(C(=O)O)/C(N)=N/[H])C(=O)O |
| InChI | InChI=1S/C8H14N6O4.ClH/c9-5(10)3(7(15)16)1-13-14-2-4(6(11)12)8(17)18;/h3-4H,1-2H2,(H3,9,10)(H3,11,12)(H,15,16)(H,17,18);1H/b14-13+; |
| InChIKey | MCXXEPTXBAJNRX-IERUDJENSA-N |
| XLogP | -0.87 |
| TPSA | 199.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride?
The IUPAC name of 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride (CID 87498740) is 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride.
What is the SMILES notation for 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride?
The canonical SMILES for 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride is Cl.[H]/N=C(\N)C(C/N=N/CC(C(=O)O)/C(N)=N/[H])C(=O)O.
What is the InChIKey of 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride?
The InChIKey is MCXXEPTXBAJNRX-IERUDJENSA-N. The full InChI is InChI=1S/C8H14N6O4.ClH/c9-5(10)3(7(15)16)1-13-14-2-4(6(11)12)8(17)18;/h3-4H,1-2H2,(H3,9,10)(H3,11,12)(H,15,16)(H,17,18);1H/b14-13+;.
What are the key properties of 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride?
3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride has a molecular weight of 294.70 g/mol, XLogP of -0.87, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[[(3-amino-2-carboxy-3-iminopropyl)diazenyl]methyl]-3-iminopropanoic acid;hydrochloride is sourced from PubChem (CID 87498740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).