C6H13N3O2 — CID 150861077
2-[(3-amino-3-imino-2-methylpropyl)amino]acetic acid (PubChem CID 150861077) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-[(3-amino-3-imino-2-methylpropyl)amino]acetic acid.
| Compound Name | 2-[(3-amino-3-imino-2-methylpropyl)amino]acetic acid |
|---|---|
| PubChem CID | 150861077 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-[(3-amino-3-imino-2-methylpropyl)amino]acetic acid |
| SMILES | [H]/N=C(\N)C(C)CNCC(=O)O |
| InChI | InChI=1S/C6H13N3O2/c1-4(6(7)8)2-9-3-5(10)11/h4,9H,2-3H2,1H3,(H3,7,8)(H,10,11) |
| InChIKey | KSAQGSFZBZFUIR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|