2-[(2-amino-2-oxoethyl)amino]acetic acid

C8H16N4O6 — CID 87871803

IUPAC2-[(2-amino-2-oxoethyl)amino]acetic acid
SMILESNC(=O)CNCC(=O)O.NC(=O)CNCC(=O)O
InChIInChI=1S/2C4H8N2O3/c2*5-3(7)1-6-2-4(8)9/h2*6H,1-2H2,(H2,5,7)(H,8,9)
InChIKeyVWMWLSLYGNTTRZ-UHFFFAOYSA-N
MW264.24 g/mol
LogP-3.71
Rot. Bonds8

About 2-[(2-amino-2-oxoethyl)amino]acetic acid

2-[(2-amino-2-oxoethyl)amino]acetic acid (PubChem CID 87871803) has the molecular formula C8H16N4O6 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(2-amino-2-oxoethyl)amino]acetic acid
PubChem CID87871803
Molecular FormulaC8H16N4O6
Molecular Weight264.24 g/mol
Exact Mass264.11
IUPAC Name2-[(2-amino-2-oxoethyl)amino]acetic acid
SMILESNC(=O)CNCC(=O)O.NC(=O)CNCC(=O)O
InChIInChI=1S/2C4H8N2O3/c2*5-3(7)1-6-2-4(8)9/h2*6H,1-2H2,(H2,5,7)(H,8,9)
InChIKeyVWMWLSLYGNTTRZ-UHFFFAOYSA-N
XLogP-3.71
TPSA184.84 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500264.24
LogP ≤ 5-3.71
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze 2-[(2-amino-2-oxoethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-amino-2-oxoethyl)amino]acetic acid?
The IUPAC name of 2-[(2-amino-2-oxoethyl)amino]acetic acid (CID 87871803) is 2-[(2-amino-2-oxoethyl)amino]acetic acid.
What is the SMILES notation for 2-[(2-amino-2-oxoethyl)amino]acetic acid?
The canonical SMILES for 2-[(2-amino-2-oxoethyl)amino]acetic acid is NC(=O)CNCC(=O)O.NC(=O)CNCC(=O)O.
What is the InChIKey of 2-[(2-amino-2-oxoethyl)amino]acetic acid?
The InChIKey is VWMWLSLYGNTTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H8N2O3/c2*5-3(7)1-6-2-4(8)9/h2*6H,1-2H2,(H2,5,7)(H,8,9).
What are the key properties of 2-[(2-amino-2-oxoethyl)amino]acetic acid?
2-[(2-amino-2-oxoethyl)amino]acetic acid has a molecular weight of 264.24 g/mol, XLogP of -3.71, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-2-oxoethyl)amino]acetic acid is sourced from PubChem (CID 87871803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).