About 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea
1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea (PubChem CID 79160800) has the molecular formula C11H24N4O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea.
Molecular Properties
| Compound Name | 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea |
| PubChem CID | 79160800 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea |
| SMILES | [H]/N=C(\N)C(C)CN(CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C11H24N4O/c1-5-14(6-2)11(16)15(7-3)8-9(4)10(12)13/h9H,5-8H2,1-4H3,(H3,12,13) |
| InChIKey | LKRIGBWMUQCNMC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea?
The IUPAC name of 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea (CID 79160800) is 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea.
What is the SMILES notation for 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea?
The canonical SMILES for 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea is [H]/N=C(\N)C(C)CN(CC)C(=O)N(CC)CC.
What is the InChIKey of 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea?
The InChIKey is LKRIGBWMUQCNMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N4O/c1-5-14(6-2)11(16)15(7-3)8-9(4)10(12)13/h9H,5-8H2,1-4H3,(H3,12,13).
What are the key properties of 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea?
1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea has a molecular weight of 228.34 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-3-imino-2-methylpropyl)-1,3,3-triethylurea is sourced from PubChem (CID 79160800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).