C8H18N4O — CID 79163244
1-(1-amino-1-iminopropan-2-yl)-3-ethyl-1,3-dimethylurea (PubChem CID 79163244) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-(1-amino-1-iminopropan-2-yl)-3-ethyl-1,3-dimethylurea.
| Compound Name | 1-(1-amino-1-iminopropan-2-yl)-3-ethyl-1,3-dimethylurea |
|---|---|
| PubChem CID | 79163244 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 1-(1-amino-1-iminopropan-2-yl)-3-ethyl-1,3-dimethylurea |
| SMILES | [H]/N=C(\N)C(C)N(C)C(=O)N(C)CC |
| InChI | InChI=1S/C8H18N4O/c1-5-11(3)8(13)12(4)6(2)7(9)10/h6H,5H2,1-4H3,(H3,9,10) |
| InChIKey | DWOIWJKPZRMPJB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|