About 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea
1-ethyl-1,3-dimethyl-3-pentan-3-ylurea (PubChem CID 116654334) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea.
Molecular Properties
| Compound Name | 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea |
| PubChem CID | 116654334 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea |
| SMILES | CCC(CC)N(C)C(=O)N(C)CC |
| InChI | InChI=1S/C10H22N2O/c1-6-9(7-2)12(5)10(13)11(4)8-3/h9H,6-8H2,1-5H3 |
| InChIKey | JKHWAGVTXDMSIL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea?
The IUPAC name of 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea (CID 116654334) is 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea.
What is the SMILES notation for 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea?
The canonical SMILES for 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea is CCC(CC)N(C)C(=O)N(C)CC.
What is the InChIKey of 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea?
The InChIKey is JKHWAGVTXDMSIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-6-9(7-2)12(5)10(13)11(4)8-3/h9H,6-8H2,1-5H3.
What are the key properties of 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea?
1-ethyl-1,3-dimethyl-3-pentan-3-ylurea has a molecular weight of 186.30 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,3-dimethyl-3-pentan-3-ylurea is sourced from PubChem (CID 116654334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).