About (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide
(2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide (PubChem CID 79011778) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide.
Molecular Properties
| Compound Name | (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide |
| PubChem CID | 79011778 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide |
| SMILES | CCC(CC)N(C)C(=O)[C@H](N)C(C)C |
| InChI | InChI=1S/C11H24N2O/c1-6-9(7-2)13(5)11(14)10(12)8(3)4/h8-10H,6-7,12H2,1-5H3/t10-/m1/s1 |
| InChIKey | FZFVEONZKNKUOO-SNVBAGLBSA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide?
The IUPAC name of (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide (CID 79011778) is (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide.
What is the SMILES notation for (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide?
The canonical SMILES for (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide is CCC(CC)N(C)C(=O)[C@H](N)C(C)C.
What is the InChIKey of (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide?
The InChIKey is FZFVEONZKNKUOO-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H24N2O/c1-6-9(7-2)13(5)11(14)10(12)8(3)4/h8-10H,6-7,12H2,1-5H3/t10-/m1/s1.
What are the key properties of (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide?
(2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide has a molecular weight of 200.33 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N,3-dimethyl-N-pentan-3-ylbutanamide is sourced from PubChem (CID 79011778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).