C14H24N2 — CID 174036176
(5Z)-2,7-dimethyl-4-prop-2-enimidoylnona-3,5-dien-3-amine (PubChem CID 174036176) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (5Z)-2,7-dimethyl-4-prop-2-enimidoylnona-3,5-dien-3-amine.
| Compound Name | (5Z)-2,7-dimethyl-4-prop-2-enimidoylnona-3,5-dien-3-amine |
|---|---|
| PubChem CID | 174036176 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (5Z)-2,7-dimethyl-4-prop-2-enimidoylnona-3,5-dien-3-amine |
| SMILES | [H]/N=C(\C=C)C(/C=C\C(C)CC)=C(N)C(C)C |
| InChI | InChI=1S/C14H24N2/c1-6-11(5)8-9-12(13(15)7-2)14(16)10(3)4/h7-11,15H,2,6,16H2,1,3-5H3/b9-8-,14-12?,15-13+ |
| InChIKey | MKPYIEHCJVDUGV-JEDMGXGOSA-N |
| XLogP | 3.66 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|