C14H21FN2 — CID 167064967
(3Z,6Z)-6-[(E)-1-fluoroprop-1-enyl]-5-imino-8-methyldeca-1,3,6-trien-3-amine (PubChem CID 167064967) has the molecular formula C14H21FN2 and a molecular weight of 236.33 g/mol. Its IUPAC name is (3Z,6Z)-6-[(E)-1-fluoroprop-1-enyl]-5-imino-8-methyldeca-1,3,6-trien-3-amine.
| Compound Name | (3Z,6Z)-6-[(E)-1-fluoroprop-1-enyl]-5-imino-8-methyldeca-1,3,6-trien-3-amine |
|---|---|
| PubChem CID | 167064967 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | (3Z,6Z)-6-[(E)-1-fluoroprop-1-enyl]-5-imino-8-methyldeca-1,3,6-trien-3-amine |
| SMILES | [H]/N=C(\C=C(/N)C=C)C(=CC(C)CC)/C(F)=C\C |
| InChI | InChI=1S/C14H21FN2/c1-5-10(4)8-12(13(15)7-3)14(17)9-11(16)6-2/h6-10,17H,2,5,16H2,1,3-4H3/b11-9-,12-8+,13-7+,17-14+ |
| InChIKey | FOSHSILPICYFDL-YILVSLKZSA-N |
| XLogP | 3.88 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|