C11H19N — CID 145244449
(3E,5Z,7R)-6,7-dimethylnona-1,3,5-trien-3-amine (PubChem CID 145244449) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (3E,5Z,7R)-6,7-dimethylnona-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z,7R)-6,7-dimethylnona-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145244449 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (3E,5Z,7R)-6,7-dimethylnona-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C=C(\C)[C@H](C)CC |
| InChI | InChI=1S/C11H19N/c1-5-9(3)10(4)7-8-11(12)6-2/h6-9H,2,5,12H2,1,3-4H3/b10-7-,11-8+/t9-/m1/s1 |
| InChIKey | XVBLKYYPTBYFBL-AXZHCJRMSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|