C8H12N2 — CID 129109676
(3E,5E)-octa-1,3,5,7-tetraene-3,6-diamine (PubChem CID 129109676) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (3E,5E)-octa-1,3,5,7-tetraene-3,6-diamine.
| Compound Name | (3E,5E)-octa-1,3,5,7-tetraene-3,6-diamine |
|---|---|
| PubChem CID | 129109676 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (3E,5E)-octa-1,3,5,7-tetraene-3,6-diamine |
| SMILES | C=C/C(N)=C\C=C(\N)C=C |
| InChI | InChI=1S/C8H12N2/c1-3-7(9)5-6-8(10)4-2/h3-6H,1-2,9-10H2/b7-5+,8-6+ |
| InChIKey | SBPHOXHPDQIHKW-KQQUZDAGSA-N |
| XLogP | 1.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|