C9H18N2 — CID 144803149
ethane;(3E)-2-N-methylhexa-1,3,5-triene-2,4-diamine (PubChem CID 144803149) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;(3E)-2-N-methylhexa-1,3,5-triene-2,4-diamine.
| Compound Name | ethane;(3E)-2-N-methylhexa-1,3,5-triene-2,4-diamine |
|---|---|
| PubChem CID | 144803149 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;(3E)-2-N-methylhexa-1,3,5-triene-2,4-diamine |
| SMILES | C=C/C(N)=C\C(=C)NC.CC |
| InChI | InChI=1S/C7H12N2.C2H6/c1-4-7(8)5-6(2)9-3;1-2/h4-5,9H,1-2,8H2,3H3;1-2H3/b7-5+; |
| InChIKey | SIZWGOXNZXZYDH-GZOLSCHFSA-N |
| XLogP | 1.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|