C5H9NS — CID 155152094
(1E)-1-methylsulfanylbuta-1,3-dien-2-amine (PubChem CID 155152094) has the molecular formula C5H9NS and a molecular weight of 115.20 g/mol. Its IUPAC name is (1E)-1-methylsulfanylbuta-1,3-dien-2-amine.
| Compound Name | (1E)-1-methylsulfanylbuta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 155152094 |
| Molecular Formula | C5H9NS |
| Molecular Weight | 115.20 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | (1E)-1-methylsulfanylbuta-1,3-dien-2-amine |
| SMILES | C=C/C(N)=C\SC |
| InChI | InChI=1S/C5H9NS/c1-3-5(6)4-7-2/h3-4H,1,6H2,2H3/b5-4+ |
| InChIKey | OLUHYIXCOVDQLJ-SNAWJCMRSA-N |
| XLogP | 1.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|