C8H13NOS — CID 143717677
N-[(2E)-2-(methylsulfanylmethylidene)but-3-enyl]acetamide (PubChem CID 143717677) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is N-[(2E)-2-(methylsulfanylmethylidene)but-3-enyl]acetamide.
| Compound Name | N-[(2E)-2-(methylsulfanylmethylidene)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 143717677 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | N-[(2E)-2-(methylsulfanylmethylidene)but-3-enyl]acetamide |
| SMILES | C=C/C(=C\SC)CNC(C)=O |
| InChI | InChI=1S/C8H13NOS/c1-4-8(6-11-3)5-9-7(2)10/h4,6H,1,5H2,2-3H3,(H,9,10)/b8-6+ |
| InChIKey | AGZPLPJOAHNBBQ-SOFGYWHQSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|